Identification |
Name: | Benzoicacid, 2-amino-5-iodo- |
Synonyms: | Anthranilicacid, 5-iodo- (6CI,8CI);5-Iodo-2-aminobenzoicacid;5-Iodoanthranilic acid;NSC 302;2-Amino-5-iodo-benzoic acid; |
CAS: | 5326-47-6 |
EINECS: | 226-205-7 |
Molecular Formula: | C7H6INO2 |
Molecular Weight: | 263.03 |
InChI: | InChI=1/C7H6INO2/c8-4-1-2-6(9)5(3-4)7(10)11/h1-3H,9H2,(H,10,11) |
Molecular Structure: |
 |
Properties |
Density: | 2.082g/cm3 |
Stability: | Stable under normal temperatures and pressures. |
Solubility: | Insoluble |
Appearance: | white to light yellow crystal powder |
HS Code: | 29224995 |
Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
Sensitive: | Light Sensitive |
Safety Data |
Hazard Symbols |
Xi:Irritant
|
|
 |