| Identification | |
| Name: | Ethyl 2-amino-4-thiazoleacetate |
| Synonyms: | Ethyl 2-aminothiazol-4-yl-acetate; EATA; Ethyl 2-(2-aminothiazol-4-yl) acetate; |
| CAS: | 53266-94-7 |
| EINECS: | 258-452-1 |
| Molecular Formula: | C7H10N2O2S |
| Molecular Weight: | 186.23 |
| InChI: | InChI=1/C7H10N2O2S/c1-2-11-6(10)3-5-4-12-7(8)9-5/h4H,2-3H2,1H3,(H2,8,9) |
| Molecular Structure: |  |
| Properties | |
| Transport: | OTH |
| Density: | 1.295 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.575 |
| Appearance: | yellow powder |
| Specification: |
Ethyl 2-amino-4-thiazoleacetate , with CAS number of 53266-94-7, can be called Ethyl 2-aminothiazol-4-yl-acetate ; Ethyl 2-aminothiazole-4-acetate ; Ethyl (2-amino-1,3-thiazol-4-yl)acetate ; Ethyl (2-amino-4-thiazolyl)acetate ; Ethyl 2-amino-4-thiazoleacetate ; Ethyl 2-(2-aminothiazol-4-yl) acetate . It is a slightly yellow to beige crystalline powder. |
| Storage Temperature: | Keep container closed when not in use. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
