| Identification | |
| Name: | Benzenemethanol,3,5-diiodo- |
| Synonyms: | 3,5-Diiodobenzylalcohol;(3,5-Diiodophenyl)methanol;3,5-Diiodobenzyl alcohol; |
| CAS: | 53279-79-1 |
| Molecular Formula: | C7H6I2O |
| Molecular Weight: | 359.93 |
| InChI: | InChI=1/C7H6I2O/c8-6-1-5(4-10)2-7(9)3-6/h1-3,10H,4H2 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 136.5-140 ºC |
| Density: | 2.441 |
| Refractive index: | 1.725 |
| Specification: |
The 3,5-Diiodobenzyl alcohol, with the CAS registry number 53279-79-1, has the systematic name of (3,5-diiodophenyl)methanol. And the molecular formula of the chemical is C7H6I2O. The characteristics of this chemical are as followings: (1)ACD/LogP: 3.62; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 3; (4)ACD/LogD (pH 7.4): 3; (5)ACD/BCF (pH 5.5): 60; (6)ACD/BCF (pH 7.4): 60; (7)ACD/KOC (pH 5.5): 651; (8)ACD/KOC (pH 7.4): 651; (9)#H bond acceptors: 1; (10)#H bond donors: 1; (11)#Freely Rotating Bonds: 2; (12)Polar Surface Area: 20.23 Å2; (13)Index of Refraction: 1.725; (14)Molar Refractivity: 58.518 cm3; (15)Molar Volume: 147.395 cm3; (16)Polarizability: 23.198×10-24cm3; (17)Surface Tension: 61.065 dyne/cm; (18)Density: 2.442 g/cm3; (19)Flash Point: 186.366 °C; (20)Enthalpy of Vaporization: 66.793 kJ/mol; (21)Boiling Point: 384.545 °C at 760 mmHg; (22)Vapour Pressure: 0 mmHg at 25°C. Addtionally, the following datas could be converted into the molecular structure: |
| Safety Data | |
 |
|
