| Identification | |
| Name: | Benzaldehyde,2,6-difluoro-4-hydroxy- |
| Synonyms: | 2,6-Difluoro-4-hydroxybenzaldehyde;2,6-Difluor-4-hydroxybenzaldehyd; |
| CAS: | 532967-21-8 |
| Molecular Formula: | C7H4F2O2 |
| Molecular Weight: | 158.10 |
| InChI: | InChI=1/C7H4F2O2/c8-6-1-4(11)2-7(9)5(6)3-10/h1-3,11H |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.464 g/cm3 |
| Refractive index: | 1.559 |
| Specification: |
The 2,6-Difluoro-4-hydroxybenzaldehyde with the CAS number 532967-21-8 is also called Benzaldehyde,2,6-difluoro-4-hydroxy-. Its molecular formula is C7H4F2O2. This chemical belongs to the following product categories: (1)Aldehyde; (2)Alcohol; (3)Halide; (4)Aromatic Aldehydes & Derivatives (substituted). It is irritant. While using this chemical, you should be very cautious. The properties of the 2,6-Difluoro-4-hydroxybenzaldehyde are: (1)ACD/LogP: 2.52; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 2.34; (4)ACD/LogD (pH 7.4): 0.92 ; (5)#H bond acceptors: 2; (6)#H bond donors: 1; (7)#Freely Rotating Bonds: 2; (8)Polar Surface Area: 37.3 Å2; (9)Index of Refraction: 1.559; (10)Molar Refractivity: 34.87 cm3; (11)Molar Volume: 107.9 cm3; (12)Polarizability: 13.82×10-24cm3; (13)Surface Tension: 46.3 dyne/cm; (14)Enthalpy of Vaporization: 50.97 kJ/mol; (15)Vapour Pressure: 0.0121 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
