| Identification | |
| Name: | Sesamol |
| Synonyms: | 3,4-(Methylenedioxy)phenol; Sesamol,(3,4-Methylenedioxyphenol); 5-Hydroxy-1,3-benzodioxole; 1,3-Benzodioxol-5-ol; 3,4-Methylenedioxyphenol ; 3,4-(Methylenedioxy) phenol |
| CAS: | 533-31-3 |
| EINECS: | 208-561-5 |
| Molecular Formula: | C7H6O3 |
| Molecular Weight: | 138.12 |
| InChI: | InChI=1/C7H6O3/c8-5-1-2-6-7(3-5)10-4-9-6/h1-3,8H,4H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 5kgs |
| Density: | 1.394 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Water Solubility: | slightly soluble |
| Solubility: | slightly soluble |
| Appearance: | white to off-white crystalline powder |
| Specification: |
?Sesamol , its CAS NO. is 533-31-3, the synonyms are 3,4-Methylenedioxyphenol ; Methylene ether of oxyhydroquinone ; 1,3-Benzodioxol-5-ol ; Phenol, 3,4-(methylenedioxy)- . |
| Report: |
Reported in EPA TSCA Inventory. |
| HS Code: | 29329970 |
| Color: | off-white to tan |
| Usage: | An antioxidant that may prevent the spoilage of oils. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
