| Identification | |
| Name: | 1,2,4-Benzenetriol |
| Synonyms: | 1,2,4-Trihydroxybenzene;1,3,4-Benzenetriol;1,3,4-Trihydroxybenzene;2,5-Dihydroxyphenol;2-Hydroxy-1,4-hydroquinone;2-Hydroxy-p-benzohydroquinone;2-Hydroxyhydroquinone;4-Hydroxycatechol;HHQ;Hydroxyhydroquinone;NSC 2818; |
| CAS: | 533-73-3 |
| EINECS: | 208-575-1 |
| Molecular Formula: | C6H6O3 |
| Molecular Weight: | 126.11 |
| InChI: | InChI=1/C6H6O3/c7-4-1-2-5(8)6(9)3-4/h1-3,7-9H |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.488 |
| Stability: | Stable under normal temperatures and pressures. May discolor on exposure to air. Light sensitive. |
| Refractive index: | 1.5445 (20 C) |
| Water Solubility: | freely soluble |
| Solubility: | freely soluble in water |
| Appearance: | dark blue powder |
| Storage Temperature: | Keep Cold |
| Sensitive: | Air Sensitive |
| Usage: | A metabolite of benzene. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
