| Identification | ||
| Name: | 2H-1,3,5-Thiadiazine-2-thione,tetrahydro-3,5-dimethyl- | |
| Synonyms: | 2-Thio-3,5-dimethyltetrahydro-1,3,5-thiadiazine;3,5-Dimethyl-2-thionotetrahydro-1,3,5-thiadiazine;3,5-Dimethyltetrahydro-1,3,5-thiadiazine-2-thione;Basamid P;Basamid-Puder;Busan 1058;Crag 974;D 35;DMTT;Dimethylformocarbothialdine;Fennosan B 100;Metasol D 3TA;Mylone;Mylone 85;N 521;Nalcon 243;Nefusan;Stauffer N 521;Tetrahydro-3,5-dimethyl-2H-1,3,5-thiodiazin-2-thione;Thiazon;Thiazone;UCC974; | |
| CAS: | 533-74-4 | |
| EINECS: | 208-576-7 | |
| Molecular Formula: | C5H10N2S2 | |
| Molecular Weight: | 162.27 | |
| InChI: | InChI=1/C5H10N2S2/c1-6-3-7(2)5(8)9-4-6/h3-4H2,1-2H3 | |
| Molecular Structure: |  |
|
| Properties | ||
| Transport: | UN3077 9/PG 3 | |
| Density: | 1.3 | |
| Refractive index: | 1.655 | |
| Water Solubility: | <0.1 g/100 mL at 18 ºC | |
| Solubility: | <0.1 g/100 mL at 18 ºC in water | |
| Appearance: | white to yellow powder | |
| Specification: | Safety Statements:15-22-24-60-61 15:Keep away from heat 22:Do not breathe dust 24:Avoid contact with skin 60:This material and/or its container must be disposed of as hazardous waste 61:Avoid release to the environment. Refer to special instructions safety data sheet | |
| Storage Temperature: | 0-6°C | |
| Color: | Colorless crystals Needles from benzene | |
| Safety Data | ||
| Hazard Symbols | ||
 |
||
