Identification |
Name: | 5-Chloro-2-mercaptobenzothiazole |
Synonyms: | 5-Chloro-2-benzothiazolethiol; 5-Chloro-2-mercaptobenzthiazol; ; 2(3H)-Benzothiazolethione,4-chloro-(9CI); 2-mercapto-5-chloro benzothiazole |
CAS: | 5331-91-9 |
EINECS: | 226-235-0 |
Molecular Formula: | C7H4ClNS2 |
Molecular Weight: | 201.69 |
InChI: | InChI=1/C7H4ClNS2/c8-4-1-2-6-5(3-4)9-7(10)11-6/h1-3H,(H,9,10) |
Molecular Structure: |
 |
Properties |
Flash Point: | 155.3°C |
Boiling Point: | 324 |
Density: | 1.6g/cm3 |
Stability: | Stable under normal temperatures and pressures. |
Refractive index: | 1.785 |
Solubility: | Insoluble |
Appearance: | Light yellow to beige solid. |
Flash Point: | 155.3°C |
Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
Safety Data |
|
 |