| Identification | |
| Name: | 3-Bromoquinoline |
| Synonyms: | - |
| CAS: | 5332-24-1 |
| EINECS: | 226-237-1 |
| Molecular Formula: | C9H6BrN |
| Molecular Weight: | 208.06 |
| InChI: | InChI=1/C9H6BrN/c10-8-5-7-3-1-2-4-9(7)11-6-8/h1-6H |
| Molecular Structure: |  |
| Properties | |
| Transport: | 150kgs |
| Flash Point: | >110 C |
| Density: | 1.533 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.663-1.665 |
| Solubility: | Insoluble |
| Appearance: | clear to yellow liquid |
| Flash Point: | >110 C |
| Storage Temperature: | Keep Cold |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
