| Identification | |
| Name: | Benzenamine,4-bromo-3-nitro- |
| Synonyms: | Aniline,4-bromo-3-nitro- (6CI,7CI);4-Bromo-3-nitroaniline;5-Amino-2-bromonitrobenzene; |
| CAS: | 53324-38-2 |
| Molecular Formula: | C6H5BrN2O2 |
| Molecular Weight: | 217.02 |
| InChI: | InChI=1/C6H5BrN2O2/c7-5-2-1-4(8)3-6(5)9(10)11/h1-3H,8H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.812g/cm3 |
| Refractive index: | 1.669 |
| Appearance: | Orange to dark brown crystalline powder |
| Specification: |
Avoid breathing dust, vapor, mist, or gas. Avoid contact with skin and eyes.Store in a cool, dry place. Store in a tightly closed container. |
| Safety Data | |
 |
|
