| Identification | |
| Name: | 1H-Pyrazole-3-carboxylicacid, 4-nitro- |
| Synonyms: | 4-nitro pyrazole-3-carboxylic acid;Pyrazole-3(or5)-carboxylic acid, 4-nitro- (6CI);Pyrazole-3-carboxylic acid, 4-nitro- (8CI);4-Nitro-1H-pyrazol-3-carboxylic acid;4-Nitro-1H-pyrazole-3-carboxylic acid;4-Nitropyrazole-3-carboxylic acid;4-Nitropyrazole-5-carboxylic acid;NSC 1411; |
| CAS: | 5334-40-7 |
| Molecular Formula: | C4H3N3O4 |
| Molecular Weight: | 157.08 |
| InChI: | InChI=1S/C4H3N3O4/c8-4(9)3-2(7(10)11)1-5-6-3/h1H,(H,5,6)(H,8,9) |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 223-225 ºC (dec.) |
| Flash Point: | 262°C |
| Boiling Point: | 360 |
| Density: | 1.84g/cm3 |
| Appearance: | White to off-white crystalline powder |
| Specification: | White to off-white crystalline powder Safety Statements:22-36/37/39-37/39-26 22:Do not breathe dust 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 37/39:Wear suitable protective clothing, gloves and eye/face protection 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| Flash Point: | 262°C |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
