| Identification | |
| Name: | 3-Pyridinecarboxylicacid, 6-amino-, hydrochloride (1:1) |
| Synonyms: | 3-Pyridinecarboxylicacid, 6-amino-, monohydrochloride (9CI);Nicotinic acid, 6-amino-, hydrochloride(8CI);6-Aminonicotinic acid monohydrochloride;6-aminopyridine-3-carboxylic acid hydrochloride;6-Amino-nicotinic acid HCl;6-Aminonicotinic acid hydrochloride;3-pyridinecarboxylic acid, 6-amino-, hydrochloride (1:1);3-Pyridinecarboxylic acid, 6-amino-, monohydrochloride; |
| CAS: | 5336-87-8 |
| Molecular Formula: | C6H6N2O2.HCl |
| Molecular Weight: | 174.585 |
| InChI: | InChI=1/C6H6N2O2.ClH/c7-5-2-1-4(3-8-5)6(9)10;/h1-3H,(H2,7,8)(H,9,10);1H |
| Molecular Structure: |  |
| Properties | |
| Density: | g/cm3 |
| Specification: |
The 6-Aminonicotinic acid hydrochloride, with the CAS registry number 5336-87-8, has the systematic name of 6-aminopyridine-3-carboxylic acid hydrochloride. It belongs to the product category of Pharmacetical. The molecular formula of the chemical is C6H6N2O2.HCl. The characteristics of this chemical are as followings: (1)ACD/LogP: 0.26; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): -1.76; (4)ACD/LogD (pH 7.4): -2.59; (5)ACD/BCF (pH 5.5): 1; (6)ACD/BCF (pH 7.4): 1; (7)ACD/KOC (pH 5.5): 1; (8)ACD/KOC (pH 7.4): 1; (9)#H bond acceptors: 4; (10)#H bond donors: 3; (11)#Freely Rotating Bonds: 1 ; (12)Flash Point: 179.8 °C; (13)Enthalpy of Vaporization: 65.5 kJ/mol; (14)Boiling Point: 373.6 °C at 760 mmHg; (15)Vapour Pressure: 3.03E-06 mmHg at 25°C. Addtionally, the following datas could be converted into the molecular structure: |
| Safety Data | |
 |
|
