| Identification | |
| Name: | 9-Acridinecarboxylicacid |
| Synonyms: | NSC 386 |
| CAS: | 5336-90-3 |
| Molecular Formula: | C14H9 N O2 |
| Molecular Weight: | 223.23 |
| InChI: | InChI=1S/C14H9NO2/c16-14(17)13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13/h1-8H,(H,16,17) |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 290 °C (dec.)(lit.) |
| Flash Point: | 244.3°C |
| Boiling Point: | 480.4°Cat760mmHg |
| Density: | 1.366g/cm3 |
| Specification: |
9-Acridinecarboxylic acid , its cas register number is 5336-90-3. It also can be called NSC 386 ; acridine-9-carboxylic acid .It is a bright yellow to yellow-green crystalline powder. |
| Flash Point: | 244.3°C |
| Safety Data | |
 |
|
