| Identification | |
| Name: | Butanoic acid,2-methyl-, (3Z)-3-hexen-1-yl ester |
| CAS: | 53398-85-9 |
| EINECS: | 258-517-4 |
| Molecular Formula: | C11H20O2 |
| Molecular Weight: | 184.2753 |
| InChI: | InChI=1S/C11H20O2/c1-4-6-7-8-9-13-11(12)10(3)5-2/h6-7,10H,4-5,8-9H2,1-3H3/b7-6- |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3077 |
| Flash Point: | 182? |
| Density: | 0.878 |
| Refractive index: | 1.432 |
| Water Solubility: | Insoluble in water; soluble in alcohol |
| Solubility: | Insoluble in water; soluble in alcohol |
| Appearance: | Colorless liquid |
| Specification: | Safety Statements:61 61:Avoid release to the environment. Refer to special instructions safety data sheet |
| Flash Point: | 182? |
| Storage Temperature: | −20°C |
| Safety Data | |
| Hazard Symbols |
N:Dangerousfortheenvironment
|
 |
|
