| Identification | |
| Name: | 2-Amino-1,3-propanediol |
| Synonyms: | Serinol; |
| CAS: | 534-03-2 |
| EINECS: | 208-584-0 |
| Molecular Formula: | C3H9NO2 |
| Molecular Weight: | 91.11 |
| InChI: | InChI=1/C3H9NO2/c4-3(1-5)2-6/h3,5-6H,1-2,4H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3263 |
| Density: | 1.181 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.4891 (20 C) |
| Solubility: | Very soluble |
| Appearance: | off-white adhering crystalline powder |
| Specification: |
?Serinol , its cas register number is 534-03-2. It also can be called?1,3-Propanediol, 2-amino- ; 2-Aminopropane-1,3-diol .It is a?white to off-white adhering crystalline powder. |
| Packinggroup: | III |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Storage under a nitrogen blanket has been recommended. Store protected from moisture. |
| Sensitive: | Hygroscopic |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
