| Identification | |
| Name: | Carbonic acid,silver(1+) salt (1:2) |
| Synonyms: | Silver carbonate(2:1);Silver(I) carbonate;Carbonic acid,disilver(1+) salt (8CI,9CI);Silver carbonate (6CI,7CI);Disilver carbonate;Fetizon's reagent;Named reagents and solutions, Fetizon's; |
| CAS: | 534-16-7 |
| EINECS: | 208-590-3 |
| Molecular Formula: | Ag2CO3 |
| Molecular Weight: | 275.74 |
| InChI: | InChI=1/CH2O3.2Ag/c2-1(3)4;;/h(H2,2,3,4);;/q;2*+1/p-2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 169.8°C |
| Boiling Point: | 333.6°Cat760mmHg |
| Density: | 6.08 |
| Stability: | Stability Stable, but light sensitive. Incompatible with reducing agents, acids. |
| Water Solubility: | insoluble |
| Solubility: | insoluble |
| Appearance: | white to light grey solid |
| Specification: |
Silver carbonate (CAS NO.534-16-7) is a catalysis and inorganic chemistry compound with the appearance of white to light grey solid. Its solubility in water is 0.0032 g/100 mL and it is soluble in acids. It can be produced by the reaction of Sodium carbonate and Silver nitrate in aqueous solutions. |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 169.8°C |
| Storage Temperature: | Store in a cool, dry place. Keep container closed when not in use. Store protected from light. |
| Usage: | Microbiocide, fungicide, herbicide. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
