| Identification | |
| Name: | Butanedioic acid,1-(1-methylethyl) 4-(tributylstannyl) ester |
| Synonyms: | Butanoicacid, 4-oxo-4-[(tributylstannyl)oxy]-, 1-methylethyl ester (9CI) |
| CAS: | 53404-82-3 |
| EINECS: | 258-537-3 |
| Molecular Formula: | C19H38 O4 Sn |
| Molecular Weight: | 449.26 |
| InChI: | InChI=1/C7H12O4.3C4H9.Sn/c1-5(2)11-7(10)4-3-6(8)9;3*1-3-4-2;/h5H,3-4H2,1-2H3,(H,8,9);3*1,3-4H2,2H3;/rC12H27Sn.C7H12O4/c1-4-7-10-13(11-8-5-2)12-9-6-3;1-5(2)11-7(10)4-3-6(8)9/h4-12H2,1-3H3;5H,3-4H2,1-2H3,(H,8,9) |
| Molecular Structure: | ![(C19H38O4Sn) Butanoicacid, 4-oxo-4-[(tributylstannyl)oxy]-, 1-methylethyl ester (9CI)](https://img1.guidechem.com/chem/e/dict/46/53404-82-3.jpg) |
| Properties | |
| Flash Point: | °C |
| Boiling Point: | °Cat760mmHg |
| Density: | g/cm3 |
| Specification: |
Tributyltin isopropylsuccinate , its cas register number is 53404-82-3. It also can be called Succinic acid, O-isopropyl-O'-tributylstannyl ester ; Isopropyl 4-oxo-4-((tributylstannyl)oxy)butyrate ; and Butanoic acid, 4-oxo-4-((tributylstannyl)oxy)-, 1- |
| Flash Point: | °C |
| Safety Data | |
| Hazard Symbols | |
 |
|
