| Identification | |
| Name: | 2,3-Butanediol,(2R,3S)-rel- |
| Synonyms: | 2,3-Butanediol,(R*,S*)-; 2,3-Butanediol, meso- (8CI); (R*,S*)-Butanediol;(R,S)-2,3-Butanediol; (erythro-) 2,3-Butanediol; NSC 2164; meso-2,3-Butanediol |
| CAS: | 5341-95-7 |
| Molecular Formula: | C4H10 O2 |
| Molecular Weight: | 90.12 |
| InChI: | InChI=1S/C4H10O2/c1-3(5)4(2)6/h3-6H,1-2H3/t3-,4+ |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 32-34 °C(lit.) |
| Flash Point: | °C |
| Boiling Point: | 183-184 °C(lit.) |
| Density: | 0.784g/cm3 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.4348 |
| Solubility: | Easily soluble in low molecular mass alcohols and ketones. Soluble in alcohol and ether. Moderately sol in diisopropyl ether. In water, miscible at 20 deg C |
| Flash Point: | °C |
| Storage Temperature: | 2-8°C |
| Color: | Nearly colorless, crystalline solid or liquid. |
| Safety Data | |
 |
|
