| Identification | |
| Name: | 1-(4-Nitrophenyl)-1H-pyridin-2-one |
| Synonyms: | 1-(4-nitrophenyl)pyridin-2(1H)-one; |
| CAS: | 53427-97-7 |
| Molecular Formula: | C11H8N2O3 |
| Molecular Weight: | 216.19 |
| InChI: | InChI=1/C11H8N2O3/c14-11-3-1-2-8-12(11)9-4-6-10(7-5-9)13(15)16/h1-8H |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.38 g/cm3 |
| Refractive index: | 1.647 |
| Specification: |
The 1-(4-Nitrophenyl)-1H-pyridin-2-one with the CAS number 53427-97-7 is also called 1-(4-nitrophenyl)pyridin-2(1H)-one. Its molecular formula is C11H8N2O3. This chemical is a kind of organics. It should be stored in dry and cool environment. The properties of the 1-(4-Nitrophenyl)-1H-pyridin-2-one are: (1)ACD/LogP: -0.06; (2)# of Rule of 5 Violations: 0 ; (3)#H bond acceptors: 5; (4)#H bond donors: 0; (5)#Freely Rotating Bonds: 2; (6)Polar Surface Area: 66.13 Å2; (7)Index of Refraction: 1.647; (8)Molar Refractivity: 56.953 cm3; (9)Molar Volume: 156.627 cm3; (10)Polarizability: 22.578×10-24cm3; (11)Surface Tension: 61.282 dyne/cm; (12)Enthalpy of Vaporization: 69.652 kJ/mol; (13)Vapour Pressure: 0 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
