| Identification | |
| Name: | Naphtho[1,2-c]furan-1,3-dione |
| Synonyms: | 1,2-Naphthalenedicarboxylicanhydride (6CI,7CI,8CI); 1,2-Naphthalic anhydride; 1,3-ab-Isonaphthofurandione; NSC 521;Naphthalene-1,2-dicarboxylic anhydride; Naphthalene-3,4-dicarboxylic anhydride |
| CAS: | 5343-99-7 |
| Molecular Formula: | C12H6 O3 |
| Molecular Weight: | 198.17 |
| InChI: | InChI=1/C12H6O3/c13-11-9-6-5-7-3-1-2-4-8(7)10(9)12(14)15-11/h1-6H |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 170°C |
| Flash Point: | 203.1°C |
| Boiling Point: | 401.9°C at 760 mmHg |
| Density: | 1.449g/cm3 |
| Refractive index: | 1.712 |
| Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Flash Point: | 203.1°C |
| Safety Data | |
 |
|
