| Identification | |
| Name: | L-Cysteine,S-[5-(acetylamino)-2-hydroxyphenyl]- |
| Synonyms: | 3-Cysteinylacetaminophen;PCM-C; Paracetamol-cysteine; S-(5-Acetamido-2-hydroxyphenyl)cysteine |
| CAS: | 53446-10-9 |
| Molecular Formula: | C11H14 N2 O4 S |
| Molecular Weight: | 384.33 |
| InChI: | InChI=1/C11H14N2O4S/c1-6(14)13-7-2-3-9(15)10(4-7)18-5-8(12)11(16)17/h2-4,8,15H,5,12H2,1H3,(H,13,14)(H,16,17)/t8-/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 281°C |
| Boiling Point: | 541.1°Cat760mmHg |
| Density: | 1.44g/cm3 |
| Stability: | Hygroscopic |
| Refractive index: | 1.654 |
| Specification: | Light Yellow Solid usageEng:APAP-CYS is a metabolite of Acetaminophen implicated in nephrotoxicity. |
| Flash Point: | 281°C |
| Usage: | A metabolite of Acetaminophen |
| Safety Data | |
 |
|
