| Identification | |
| Name: | 5-Bromo-6-methoxy-8-nitroquinoline |
| Synonyms: | 5-Bromo-6-methoxy-8-nitroquinoline;quinoline, 5-bromo-6-methoxy-8-nitro- |
| CAS: | 5347-15-9 |
| Molecular Formula: | C10H7BrN2O3 |
| Molecular Weight: | 283.0782 |
| InChI: | InChI=1/C10H7BrN2O3/c1-16-8-5-7(13(14)15)10-6(9(8)11)3-2-4-12-10/h2-5H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 202.4°C |
| Boiling Point: | 411°C at 760 mmHg |
| Density: | 1.676g/cm3 |
| Refractive index: | 1.67 |
| Specification: |
5-Bromo-6-methoxy-8-nitroquinoline (CAS NO.5347-15-9) is also named as 4-21-00-01125 (Beilstein Handbook Reference) ; AI3-18683 ; BRN 0207336 ; NSC 3750 ; Quinoline, 5-bromo-6-methoxy-8-nitro- . 5-Bromo-6-methoxy-8-nitroquinoline (CAS NO.5347-15-9) is highly toxic. It will produce toxic nitrogen oxide and bromides smoke by heat. So the storage environment should be ventilate, low-temperature and dry. Keep 5-Bromo-6-methoxy-8-nitroquinoline (CAS NO.5347-15-9) separate from raw materials of food. |
| Flash Point: | 202.4°C |
| Safety Data | |
 |
|
