| Identification | |
| Name: | 1-PHENOXY-2-CHLOROPROPANE |
| Synonyms: | (2-Chloropropoxy)Benzene;-Chloropropoxybenzene;phenoxychloropropane;1-PHENOXY-2-CHLOROPROPANE;2-CHLOROPROPYL PHENYL ETHER;1-PHENOXY-2-CHLOROPROPANE 97+%;2-Chloro-1-phenoxypropane |
| CAS: | 53491-30-8 |
| Molecular Formula: | C9H11ClO |
| Molecular Weight: | 170.64 |
| InChI: | InChI=1/C9H11ClO/c1-8(10)7-11-9-5-3-2-4-6-9/h2-6,8H,7H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 98.4°C |
| Boiling Point: | 95 °C / 5mmHg |
| Density: | 1,11 g/cm3 |
| Refractive index: | 1.506 |
| Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Flash Point: | 98.4°C |
| Safety Data | |
 |
|
