| Identification | |
| Name: | Thiazole,4,5-dimethyl-2-(1-methylethyl)- |
| Synonyms: | 2-Isopropyl-4,5-dimethylthiazole;4,5-Dimethyl-2-isopropylthiazole; |
| CAS: | 53498-30-9 |
| Molecular Formula: | C8H13NS |
| Molecular Weight: | 155.26 |
| InChI: | InChI=1/C8H13NS/c1-5(2)8-9-6(3)7(4)10-8/h5H,1-4H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.003 g/cm3 |
| Refractive index: | 1.513 |
| Appearance: | pale yellow liquid |
| Specification: |
The 4,5-Dimethyl-2-isopropylthiazole with its cas register number is 53498-30-9. It also can be called as Thiazole,4,5-dimethyl-2-(1-methylethyl)- and the IUPAC Name about this chemical is 4,5-dimethyl-2-propan-2-yl-1,3-thiazole. It belongs to the API intermediates and thiazole Flavor. Physical properties about 4,5-Dimethyl-2-isopropylthiazole are: (1)ACD/LogP: 2.90; (2)ACD/LogD (pH 5.5): 2.87; (3)ACD/LogD (pH 7.4): 2.9; (4)ACD/BCF (pH 5.5): 87.21; (5)ACD/BCF (pH 7.4): 94.19; (6)ACD/KOC (pH 5.5): 833.72; (7)ACD/KOC (pH 7.4): 900.49; (8)#H bond acceptors: 1; (9)#Freely Rotating Bonds: 1; (10)Polar Surface Area: 41.13Å2; (11)Index of Refraction: 1.513; (12)Molar Refractivity: 46.56 cm3; (13)Molar Volume: 154.7 cm3; (14)Polarizability: 18.45x10-24cm3; (15)Surface Tension: 34.4 dyne/cm; (16)Enthalpy of Vaporization: 42.8 kJ/mol; (17)Vapour Pressure: 0.286 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
