| Identification | |
| Name: | Benzoicacid, 3,5-diamino- |
| Synonyms: | BRN 2086484;CCRIS 2885; |
| CAS: | 535-87-5 |
| EINECS: | 208-621-0 |
| Molecular Formula: | C7H8N2O2 |
| Molecular Weight: | 152.15 |
| InChI: | InChI=1/C7H8N2O2/c8-5-1-4(7(10)11)2-6(9)3-5/h1-3H,8-9H2,(H,10,11) |
| Molecular Structure: |  |
| Properties | |
| Density: | g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.71? |
| Solubility: | Very soluble |
| Appearance: | White to grey powder |
| HS Code: | 29224995 |
| Storage Temperature: | Store in a cool, dry place. Store in a tightly closed container. |
| Usage: | Detection and determination of nitrites. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
