| Identification | |
| Name: | Bis-hm-A-tda |
| Synonyms: | 2-[N,N-Bis(hydroxymethyl)amino]-1,3,4-thiadiazole;BIS-HM-A-TDA |
| CAS: | 53532-37-9 |
| Molecular Formula: | C4H7N3O2S |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C4H7N3O2S/c8-2-7(3-9)4-6-5-1-10-4/h1,8-9H,2-3H2 |
| Molecular Structure: | ![(C4H7N3O2S) 2-[N,N-Bis(hydroxymethyl)amino]-1,3,4-thiadiazole;BIS-HM-A-TDA](https://img.guidechem.com/crawlimg/53532-37-9.png) |
| Properties | |
| Flash Point: | 156.9°C |
| Boiling Point: | 335.8°C at 760 mmHg |
| Density: | 1.638g/cm3 |
| Refractive index: | 1.704 |
| Specification: |
The extinguishing agent of Bis-hm-A-tda (CAS NO.53532-37-9 ) are dry powder, foam, sand, carbon dioxide, water mist. |
| Flash Point: | 156.9°C |
| Safety Data | |
 |
|
