| Identification | |
| Name: | 3(or 5)-chloro[1,1'-biphenyl]-2-ol |
| Synonyms: | 3(or 5)-Chloro(1,1'-biphenyl)-2-ol;4(or 6)-Chloro-2-phenylphenol;Dowicide 31;(1,1'-Biphenyl)-2-ol, 3(or 5)-chloro-;(1,1'-Biphenyl)-2-ol, 5-chloro-, sodium salt (40%), mixture with sodium salts of (1,1'-biphenyl)-2-ol (20%) and 3-chloro(1,1'-biphenyl)-2-ol (12%) in water |
| CAS: | 53537-62-5 |
| EINECS: | 258-616-2 |
| Molecular Formula: | C12H9ClO |
| Molecular Weight: | 204.6551 |
| InChI: | InChI=1/C12H9ClO/c13-11-8-4-7-10(12(11)14)9-5-2-1-3-6-9/h1-8,14H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 138.8°C |
| Boiling Point: | 317.5°Cat760mmHg |
| Density: | 1.239g/cm3 |
| Flash Point: | 138.8°C |
| Safety Data | |
 |
|
