| Identification |
| Name: | Carbonic acid, dithio-,O-sec-butyl ester, S-ester with 3-mercaptopropionitrile (8CI) |
| Synonyms: | Xanthicacid, sec-butyl-, ester with 3-mercaptopropionitrile (7CI); Propionitrile,3-mercapto-, O-sec-butyl dithiocarbonate (ester); Xanthic acid, sec-butyl-,2-cyanoethyl ester; Xanthic acid, sec-butyl-, ester with3-mercaptopropionitrile |
| CAS: | 5356-62-7 |
| Molecular Formula: | C8H13 N O S2 |
| Molecular Weight: | 257.2447 |
| InChI: | InChI=1/C13H11N3O3/c1-9-4-5-11(12(7-9)16(18)19)15-13(17)10-3-2-6-14-8-10/h2-8H,1H3,(H,15,17) |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 169.1°C |
| Boiling Point: | 356°Cat760mmHg |
| Density: | 1.356g/cm3 |
| Refractive index: | 1.663 |
| Flash Point: | 169.1°C |
| Safety Data |
| |
 |
