| Identification | |
| Name: | Benzeneethanamine,4-bromo-2,5-dimethoxy-a-methyl-, hydrobromide (1:1) |
| CAS: | 53581-53-6 |
| Molecular Formula: | C11H16 Br N O2 . Br H |
| Molecular Weight: | 341.10 |
| InChI: | InChI=1/C11H16BrNO2.BrH/c1-7(13)4-8-5-11(15-3)9(12)6-10(8)14-2;/h5-7H,4,13H2,1-3H3;1H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2811 6.1/PG 2 |
| Flash Point: | 159.9°C |
| Boiling Point: | 340.8°C at 760 mmHg |
| Specification: |
Dl-4-bromo-2,5-dimethoxyamphetamine hydrobromide with cas registry number of 53581-53-6 is also known as (+/-)-2,5-Dimethoxy-4-bromo-amphetamine hydrobromide ; [+/-]-Dob hydrobromide ; 4-Bromo-2,5-dimethoxy-alpha-methyl-,hydrobromide,dl-phenethylamin ; Dl-2,5-dimethoxy-4-bromoamphetaminehydrobromide ; Dl-4-bromo-2,5-dimethoxy-alpha-methylphenethylaminehydrobromide ; Dl-4-bromo-2,5-dimethoxyamphetaminehydrobromide ; Dob ; (+-)-2,5-Dimethoxy-4-bromoamphetamine*hydrobromid . It is a compound with the appearance of crystals. Dl-4-bromo-2,5-dimethoxyamphetamine hydrobromide is used as a useful organic synthesis intermediate. This compound should be stored in a tightly closed container when not in use and stored in a cool, dry place. |
| Packinggroup: | I |
| Flash Point: | 159.9°C |
| Safety Data | |
 |
|
