| Identification | |
| Name: | L-Tyrosine-2,3,6-d3,5-hydroxy- (9CI) |
| Synonyms: | L-Dihydroxyphenylalanine-2H3; |
| CAS: | 53587-29-4 |
| Molecular Formula: | C9H8D3NO4 |
| Molecular Weight: | 200.21 |
| InChI: | InChI=1/C9H11NO4/c10-6(9(13)14)3-5-1-2-7(11)8(12)4-5/h1-2,4,6,11-12H,3,10H2,(H,13,14)/t6-/m0/s1/i1D,2D,4D |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 292 °C (dec.)(lit.) |
| Flash Point: | 225°C |
| Boiling Point: | 448.4°C at 760 mmHg |
| Density: | 1.49g/cm3 |
| Refractive index: | 1.654 |
| Specification: | White Solid usageEng:Natural isomer of the immediate precursor of dopamine; product of tyrsine hydroxylase Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Flash Point: | 225°C |
| Usage: | Natural isomer of the immediate precursor of dopamine; product of tyrsine hydroxylase |
| Safety Data | |
 |
|
