| Identification | |
| Name: | Benzoic acid,4-chloro-, hydrazide |
| Synonyms: | Benzoicacid, p-chloro-, hydrazide (6CI,7CI,8CI);(4-Chlorobenzoyl)hydrazine;4-Chlorobenzenecarboxylic acid hydrazide;4-Chlorobenzhydrazide;4-Chlorobenzohydrazide;4-Chlorobenzoic acid hydrazide;4-Chlorobenzoichydrazide;4-Chlorobenzoylhydrazide;INHd 15;NSC 54990;p-Chlorobenzhydrazide;p-Chlorobenzohydrazide;p-Chlorobenzoic acid hydrazide;p-Chlorobenzoichydrazide;p-Chlorobenzoyl hydrazide;p-Chlorobenzoylhydrazine; |
| CAS: | 536-40-3 |
| EINECS: | 208-632-0 |
| Molecular Formula: | C7H7ClN2O |
| Molecular Weight: | 170.5961 |
| InChI: | InChI=1S/C7H7ClN2O/c8-6-3-1-5(2-4-6)7(11)10-9/h1-4H,9H2,(H,10,11) |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 162-165 °C(lit.) |
| Flash Point: | 156.2°C |
| Density: | 1.323g/cm3 |
| Refractive index: | 1.592 |
| Appearance: | white to light beige crystals |
| Specification: | white to light beige crystals, flakes or Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Flash Point: | 156.2°C |
| Safety Data | |
 |
|
