| Identification | |
| Name: | 1-Propanone,1-(4-butoxyphenyl)-3-(1-piperidinyl)-, hydrochloride (1:1) |
| Synonyms: | 1-Propanone,1-(4-butoxyphenyl)-3-(1-piperidinyl)-, hydrochloride (9CI);Propiophenone,4'-butoxy-3-piperidino-, hydrochloride (7CI,8CI);4'-Butoxy-3-piperidinopropiophenone hydrochloride;Diclonina;Diclonine;Dyclothane;Tanaclone; |
| CAS: | 536-43-6 |
| EINECS: | 208-633-6 |
| Molecular Formula: | C18H27NO2.HCl |
| Molecular Weight: | 325.87 |
| InChI: | InChI=1/C18H27NO2.ClH/c1-2-3-15-21-17-9-7-16(8-10-17)18(20)11-14-19-12-5-4-6-13-19;/h7-10H,2-6,11-15H2,1H3;1H |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3249 |
| Melting Point: | 175-176 ºC |
| Density: | g/cm3 |
| Specification: | White Crystalline Solid usageEng:Used as a local anesthetic Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Packinggroup: | III |
| Usage: | Used as a local anesthetic |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
|
 |
|
