| Identification | |
| Name: | 4-Isopropylbenzoic acid |
| Synonyms: | Benzoicacid, p-isopropyl- (6CI,8CI);4-(1-Methylethyl)benzoic acid;4-Isopropylbenzoicacid;Cumic acid;Cuminic acid;p-Isopropylbenzoic acid; |
| CAS: | 536-66-3 |
| EINECS: | 208-642-5 |
| Molecular Formula: | C10H12O2 |
| Molecular Weight: | 164.2 |
| InChI: | InChI=1/C10H12O2/c1-7(2)8-3-5-9(6-4-8)10(11)12/h3-7H,1-2H3,(H,11,12) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.08g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.535 |
| Water Solubility: | sparingly soluble |
| Solubility: | sparingly soluble |
| Appearance: | white crystalline powder |
| Specification: |
? 4-Isopropylbenzoic acid , with CAS number of 536-66-3, can be called 4-Isopropyl Benzoic Acid; Cuminic acid; 4-(1-Methylethyl)benzoic acid ; 4-(1-methylethyl)-benzoicaci; 4-(1-methylethyl)benzoicacid . It is a?white crystalline powder.?4-Isopropylbenzoic acid (CAS NO.536-66-3) is used for pharmaceutical intermediates. |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
