| Identification | |
| Name: | Benzenecarboximidamide,4,4'-(1-triazene-1,3-diyl)bis- |
| Synonyms: | Benzamidine,4,4'-(diazoamino)di- (6CI,7CI,8CI);1,3-Bis(p-amidinophenyl)triazene;4,4'-Diamidinodiazoaminobenzene;MP 601206;WR 27800; |
| CAS: | 536-71-0 |
| EINECS: | 208-644-6 |
| Molecular Formula: | C14H15N7 |
| Molecular Weight: | 281.3158 |
| InChI: | InChI=1S/C14H15N7/c15-13(16)9-1-5-11(6-2-9)19-21-20-12-7-3-10(4-8-12)14(17)18/h1-8H,(H3,15,16)(H3,17,18)(H,19,20) |
| Molecular Structure: |  |
| Properties | |
| Transport: | OTH |
| Melting Point: | 212 - 214 C |
| Flash Point: | 234°C |
| Boiling Point: | 463.3°Cat760mmHg |
| Density: | 1.39g/cm3 |
| Refractive index: | 1.707 |
| Water Solubility: | 6.67 mg/l |
| Solubility: | 6.67 mg/l
Appearance:yellow to orange powder Transport Information: OTH Hazard Symbols:UN NO. |
| Appearance: | yellow to orange powder |
| Specification: |
Diminazene , its cas register number is 536-71-0. It also can be called Diminazene [INN:BAN] ; 4,4'-(1-Triazene-1,3-diyl)bis-benzenecarboximidamide ; Diminazeno ; Diminazenum ; 4,4'-(Diazoamino)benzamidine ; Benzenecarboximidamide, 4,4'-(1-triazene-1,3-diyl)bis- .It is an effective trypanocidal agent. |
| Flash Point: | 234°C |
| Safety Data | |
| Hazard Symbols | |
 |
|
