| Identification | |
| Name: | 3a,4,7,7a-Tetrahydro-4,7-methano-1H-indene, ethenylacetate copolymer |
| Synonyms: | 3a,4,7,7a-Tetrahydro-4,7-methano-1H-indene,ethenylacetate copolymer;Acetic acid ethenyl ester, polymer with 3a,4,7,7a-tetrahydro-4,7-methano-1H-indene;acetic acid ethenyl ester, polymer with3a,4,7,7a-tetrahydro-4,7-methano-1h-indene;Acetic acid ethenyl ester,polymer with 3a,4,7,7a-tetrahydro-4,7-methano-1H-indene |
| CAS: | 53640-62-3 |
| Molecular Formula: | C14H18O2 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C10H12.C4H6O2/c1-2-9-7-4-5-8(6-7)10(9)3-1;1-3-6-4(2)5/h1-2,4-5,7-10H,3,6H2;3H,1H2,2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 46.8°C |
| Boiling Point: | 170°C at 760 mmHg |
| Flash Point: | 46.8°C |
| Safety Data | |
 |
|
