| Identification | |
| Name: | Benzene,4-methoxy-2-methyl-1-nitro- |
| Synonyms: | Anisole,3-methyl-4-nitro- (6CI,7CI,8CI);2-Methyl-4-methoxynitrobenzene;2-Nitro-5-methoxytoluene;3-Methyl-4-nitrophenolmethyl ether;4-Methoxy-2-methyl-1-nitrobenzene;5-Methoxy-2-nitrotoluene;NSC37985; |
| CAS: | 5367-32-8 |
| EINECS: | 226-356-9 |
| Molecular Formula: | C8H9NO3 |
| Molecular Weight: | 167.16 |
| InChI: | InChI=1/C8H9NO3/c1-6-5-7(12-2)3-4-8(6)9(10)11/h3-5H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 135.1°C |
| Boiling Point: | 135 °C / 0.5mmHg |
| Density: | 1.18g/cm3 |
| Stability: | No data. |
| Refractive index: | 1.538 |
| Appearance: | Yellow powder. |
| Specification: | yellow to brown powder Safety Statements:24/25-36-26 24/25:Avoid contact with skin and eyes 36:Wear suitable protective clothing 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| Flash Point: | 135.1°C |
| Storage Temperature: | Store in a cool, dry place. Store in a tightly closed container. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
