| Identification | |
| Name: | Thiophene,3,4-bis(chloromethyl)-2,5-dimethyl- |
| Synonyms: | 3,4-Bis(chloromethyl)-2,5-dimethylthiophene;NSC 149595; |
| CAS: | 5368-70-7 |
| Molecular Formula: | C8H10Cl2S |
| Molecular Weight: | 209.14 |
| InChI: | InChI=1/C8H10Cl2S/c1-5-7(3-9)8(4-10)6(2)11-5/h3-4H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 165.9°C |
| Boiling Point: | 283.9°Cat760mmHg |
| Density: | 1.253g/cm3 |
| Refractive index: | 1.558 |
| Specification: |
The 3,4-Bis(chloromethyl)-2,5-dimethylthiophene, with the cas registry number 5368-70-7, has the systematic name and IUPAC name same to its self. It is a kind of corrosive chemical , so you should be cautious while dealing with it. And the molecular formula of the chemical is C8H10Cl2S. The characteristics of this chemical are as followings: (1)ACD/LogP: 3.34; (2)# of Rule of 5 Violations: 0; (3)#H bond acceptors: 0; (4)#H bond donors: 0; (5)#Freely Rotating Bonds: 2; (6)Polar Surface Area: 28.24 Å2; (7)Index of Refraction: 1.558; (8)Molar Refractivity: 53.81 cm3; (9)Molar Volume: 166.8 cm3; (10)Polarizability: 21.33×10-24cm3; (11)Surface Tension: 38.7 dyne/cm; (12)Density: 1.253 g/cm3; (13)Flash Point: 165.9 °C; (14)Enthalpy of Vaporization: 50.19 kJ/mol; (15)Boiling Point: 283.9 °C at 760 mmHg; (16)Vapour Pressure: 0.00526 mmHg at 25°C. Addtionally, the following datas could be converted into the molecular structure: |
| Flash Point: | 165.9°C |
| Safety Data | |
 |
|
