| Identification | |
| Name: | Ethanone,2-chloro-1-(3-fluorophenyl)- |
| Synonyms: | m-Fluorophenacylchloride;a-Chloro-3'-fluoroacetophenone; |
| CAS: | 53688-18-9 |
| Molecular Formula: | C8H6ClFO |
| Molecular Weight: | 172.58 |
| InChI: | InChI=1/C8H6ClFO/c9-5-8(11)6-2-1-3-7(10)4-6/h1-4H,5H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.264 g/cm3 |
| Refractive index: | 1.514 |
| Specification: |
The systematic name of 2-Chloro-5'-fluoroacetophenone is 2-chloro-1-(3-fluorophenyl)ethanone . With the CAS registry number 53688-18-9, it is also named as 2-Chloro-1-(3-fluorophenyl)ethanone ; Ethanone, 2-chloro-1-(3-fluorophenyl)- ; 3'-Fluorophenacyl chloride ; Ethanone, 2-chloro-1-(3-fluorophenyl)- (9CI) . It is used as medical biological chemical intermediates. 2-Chloro-5'-fluoroacetophenone can be prepared from pchlorofluorobenzene and acetyl chloride . People can use the following data to convert to the molecule structure. SMILES: O=C(CCl)c1cc(F)ccc1; InChI: InChI=1/C8H6ClFO/c9-5-8(11)6-2-1-3-7(10)4-6/h1-4H,5H2. |
| Safety Data | |
 |
|
