Identification |
Name: | Poly(oxy-1,2-ethanediyl),a-hydro-w-hydroxy-, ether with D-glucitol(6:1) |
Synonyms: | AtlasG 2004; Atlas G 2320; Atlas G 2330; Blaunon 240; Ethoxylated D-sorbitol;Ethoxylated sorbitol; Ethylene oxide polymer sorbitol ether; G 2320; G 2330;Imbentin SOR 060; Macol 215-124; Polyethylene glycol ether with sorbitol;Polyethylene glycol hexaether with sorbitol; Polyethylene glycol sorbitolether; Polyethylene sorbitol; Polyol RQ 490; Polyoxyethylene sorbitol; RQ 490;Sorbeth 20; Sorbeth 30; Sorbeth 6; Tego SO 6 |
CAS: | 53694-15-8 |
EINECS: | 500-121-3 |
Molecular Formula: | (C2H4 O)n (C2 H4 O)n (C2 H4 O)n (C2 H4 O)n (C2 H4 O)n (C2 H4 O)n C6 H14 O6 |
Molecular Weight: | 0 |
InChI: | InChI=1/C18H38O12/c19-1-7-25-13-15(27-9-3-21)17(29-11-5-23)18(30-12-6-24)16(28-10-4-22)14-26-8-2-20/h15-24H,1-14H2 |
Molecular Structure: |
|
Properties |
Flash Point: | 337.4°C |
Boiling Point: | 634.3°Cat760mmHg |
Density: | 1.274g/cm3 |
Refractive index: | 1.51 |
Flash Point: | 337.4°C |
Safety Data |
|
|