| Identification | |
| Name: | Prostaglandin E2 sodium salt |
| Synonyms: | PGE2 sodium salt;Prostaglandin E2 sodium salt;U 12062A;(5Z,11-alpha,13E,15S)-11,15-Dihydroxy-9-oxoprosta-5,13-dien-1-oic acid monosodium salt;Prosta-5,13-dien-1-oic acid, 11,15-dihydroxy-9-oxo-, monosodium salt, (5Z,11-alpha,13E,15S)-;LS-125827;53697-17-9 |
| CAS: | 53697-17-9 |
| Molecular Formula: | C20H32O5 . Na |
| Molecular Weight: | 374.4469 |
| InChI: | InChI=1/C20H32O5.Na/c1-2-3-6-9-15(21)12-13-17-16(18(22)14-19(17)23)10-7-4-5-8-11-20(24)25;/h4,7,12-13,15-17,19,21,23H,2-3,5-6,8-11,14H2,1H3,(H,24,25);/q;+1/p-1/b7-4-,13-12+;/t15-,16+,17+,19+;/m0./s1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 288.4°C |
| Boiling Point: | 530.1°C at 760 mmHg |
| Specification: |
Prostaglandin E2 sodium salt , its cas register number is 53697-17-9. It also can be called PGE2 sodium salt ; and (5Z,11-alpha,13E,15S)-11,15-Dihydroxy-9-oxoprosta-5,13-dien-1-oic acid monosodium salt . |
| Flash Point: | 288.4°C |
| Safety Data | |
 |
|
