Identification |
Name: | Benzoic acid,2-hydroxy-4-[(2-hydroxy-4-methoxy-6-methylbenzoyl)oxy]-6-methyl- |
Synonyms: | 2,6-Cresoticacid, 4-methoxy-, 4-ester with 6-methyl-b-resorcylic acid (7CI,8CI); Evernic acid (6CI); NSC81164 |
CAS: | 537-09-7 |
EINECS: | 208-658-2 |
Molecular Formula: | C17H16 O7 |
Molecular Weight: | 332.3 |
InChI: | InChI=1/C9H10O4/c1-5-3-6(13-2)4-7(10)8(5)9(11)12/h3-4,10H,1-2H3,(H,11,12) |
Molecular Structure: |
 |
Properties |
Melting Point: | 166-167°C |
Flash Point: | 194.6°C |
Boiling Point: | 531.8°Cat760mmHg |
Density: | 1.391g/cm3 |
Refractive index: | 1.576 |
Flash Point: | 194.6°C |
Safety Data |
|
 |