| Identification | |
| Name: | N-Acetyl-L-tyrosine |
| Synonyms: | (2S)-2-acetamido-3-(4-hydroxyphenyl)propanoic acid;Tyrosine, N-acetyl-, L- (8CI);L-Tyrosine, N-acetyl-;Tyrosine, N-acetyl-, L-;N-Acetyltyrosine (VAN);Acetyl-L-Tyrosine;Ac-Tyr-OH; |
| CAS: | 537-55-3 |
| EINECS: | 208-671-3 |
| Molecular Formula: | C11H13NO4 |
| Molecular Weight: | 223.23 |
| InChI: | InChI=1/C11H13NO4/c1-7(13)12-10(11(15)16)6-8-2-4-9(14)5-3-8/h2-5,10,14H,6H2,1H3,(H,12,13)(H,15,16)/t10-/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.304 g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Alpha: | 47.5 o (C=2, WATER) |
| Appearance: | White to off-white crystalline powder |
| Specification: |
?N-Acetyl-L-tyrosine , its cas register number is . It also can be called?Acetyl tyrosine ; L-Tyrosine, N-acetyl- ; N-Acetyltyrosine?; Tyrosine, N-acetyl-, L- (8CI) . It is a?solid. |
| HS Code: | 29242995 |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
