| Identification | |
| Name: | Benzenamine, N-phenyl-,hydrochloride (1:1) |
| Synonyms: | Benzenamine,N-phenyl-, hydrochloride (9CI);Diphenylamine, hydrochloride (8CI);Diphenylammonium chloride;N-Phenylaniline hydrochloride; |
| CAS: | 537-67-7 |
| EINECS: | 208-675-5 |
| Molecular Formula: | C12H12ClN |
| Molecular Weight: | 205.6834 |
| InChI: | InChI=1/C12H11N.ClH/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;/h1-10,13H;1H |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.088g/cm3 |
| Solubility: | 1 g dissolves in 2.2 ml of alcohol, 4 ml propyl alcohol; Freely sol in benzene, ether, glacial acetic acid, carbon disulfide. Very sol in ethanol, acetone, benzene, carbon tetrachloride, pyridine, ethyl acetate; sol in ether, acetic acid; slightly sol in chloroform Soluble in oxygenated and aromatic solvents In water, 53 mg/liter @ 20 deg C |
| Appearance: | white to off-white solid |
| Color: | Monoclinic leaflets from dilute alcohol Crystals Colorless, tan, amber, or brown crystalline solid. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
