| Identification | |
| Name: | b-Alanine,N-(3-methoxy-3-oxopropyl)-N-phenyl-, methyl ester |
| Synonyms: | Propionicacid, 3,3'-(phenylimino)di-, dimethyl ester (7CI);N,N-Bis(2-methoxycarboxyethyl)aniline;N,N-Bis[2-(methoxycarbonyl)ethyl]aniline; N,N-Di(b-methoxycarbonylethyl)aniline |
| CAS: | 53733-94-1 |
| EINECS: | 258-731-8 |
| Molecular Formula: | C14H19 N O4 |
| Molecular Weight: | 265.3 |
| InChI: | InChI=1/C14H19NO4/c1-18-13(16)8-10-15(11-9-14(17)19-2)12-6-4-3-5-7-12/h3-7H,8-11H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.136 g/cm3 |
| Refractive index: | 1.528 |
| Specification: |
b-Alanine,N-(3-methoxy-3-oxopropyl)-N-phenyl-, methyl ester , its cas register number 53733-94-1. It also can be called N-(2-Carboxyethyl)-N-phenyl-beta-alanine, dimethyl ester ; Methyl N-(3-methoxy-3-oxopropyl)-N-phenyl-beta-alaninate ; and Methyl 3-[(3-methoxy-3-oxopropyl)phenylamino]propanoate . |
| Safety Data | |
 |
|
