| Identification | |
| Name: | Phenol,2-amino-4-arsinyl-, hydrochloride (1:1) |
| Synonyms: | Phenol,2-amino-4-arsenoso-, hydrochloride (6CI,7CI,8CI); Phenol, 2-amino-4-arsenoso-,monohydrochloride (9CI); 2-Amino-4-arsenosophenol hydrochloride;3-Amino-4-hydroxyphenylarsine oxide hydrochloride; Arseno 39; Arsenosan;Arsenoxide; Arsphenoxide; Ehrlich 5; Fontarsan; Mapharsal; Mapharsen;Mapharside; Maspharside; Metarsen; NSC 627725; Oxiarsolan; Oxophenarsinehydrochloride; Treparsen |
| CAS: | 538-03-4 |
| EINECS: | 208-682-3 |
| Molecular Formula: | C6H6 As N O2 . Cl H |
| Molecular Weight: | 235.51 |
| InChI: | InChI=1/C6H6AsNO2.ClH/c8-5-3-4(7-10)1-2-6(5)9;/h1-3,9H,8H2;1H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | °C |
| Boiling Point: | °Cat760mmHg |
| Density: | g/cm3 |
| Specification: |
Arsphenoxide (CAS NO.538-03-4) is also named as 2-Amino-4-arsenosophenol hydrochloride ; 3-Amino-4-hydroxy-phenarsine hydrochloride ; 3-Amino-4-hydroxyphenyl arsinoxide hydrochloride ; 3-Amino-4-hydroxyphenylarsine oxide hydrochloride ; AI3-04455 ; Arseno 39 ; Arsenosan ; Arsenoxide ; Ehrlich 5 ; Fontarsan ; Mapharsal ; Mapharsen ; Mapharside ; Metarsen ; NSC 3087 ; Oxiarsolan ; Oxophenarsine HCl ; Oxophenarsine hydrochloride ; Oxophenarsini hydrochloridum ; Treparsen . Arsphenoxide (CAS NO.538-03-4) is highly toxic. It is flammable. It will produce toxic nitrogen oxides, arsenic and hydrogen chloride fumes when buring. So the storage environment should be ventilate, low-temperature and dry. Keep Arsphenoxide (CAS NO.538-03-4) separate from raw materials of food. |
| Report: |
Arsenic and its compounds are on the Community Right-To-Know List. |
| Flash Point: | °C |
| Safety Data | |
 |
|
