| Identification | |
| Name: | Isobutylbenzene |
| Synonyms: | 2-Methyl-1-phenylpropane; Isobutylbenzene,99%; 1-Phenylisobutane; isobutyl benzene; (2-methylpropyl)-benzene |
| CAS: | 538-93-2 |
| EINECS: | 208-706-2 |
| Molecular Formula: | C10H14 |
| Molecular Weight: | 134.22 |
| InChI: | InChI=1/C10H14/c1-9(2)8-10-6-4-3-5-7-10/h3-7,9H,8H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3295 |
| Density: | 0.85 |
| Refractive index: | 1.485-1.487 |
| Water Solubility: | INSOLUBLE |
| Solubility: | insoluble in water |
| Appearance: | Clear liquid |
| Specification: |
Isobutylbenzene (CAS NO.538-93-2) is also named as (2-Methylpropyl)benzene ; 1-Phenyl-2-methylpropane ; 2-Methyl-1-phenylpropane ; 2-Phenyl-2-methylpropane ; 4-05-00-01042 (Beilstein Handbook Reference) ; BRN 1852218 ; NSC 24848 ; Benzene, (2-methylpropyl)- ; Benzene, isobutyl- . Isobutylbenzene (CAS NO.538-93-2) is colorless liquid. It is insoluble in water, soluble in alcohol, ether, benzene and acetone. It is toxic. It is flammable. So the storage environment should be ventilate, low-temperature and dry. Keep Isobutylbenzene separate from oxidant. |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| Storage Temperature: | Flammables area |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
