| Identification | |
| Name: | 2-Thiophenecarboxylicacid, methyl ester |
| Synonyms: | 2-(Carbomethoxy)thiophene;2-(Methoxycarbonyl)thiophene; Methyl 2-thienylcarboxylate; Methyl2-thiophenecarboxylate; NSC 19879 |
| CAS: | 5380-42-7 |
| EINECS: | 226-371-0 |
| Molecular Formula: | C6H6 O2 S |
| Molecular Weight: | 142.17 |
| InChI: | InChI=1/C6H6O2S/c1-8-6(7)5-3-2-4-9-5/h2-4H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 74.9°C |
| Density: | 1.23 |
| Refractive index: | 1.5405-1.5435 |
| Specification: |
2-(Methoxycarbonyl)thiophene , its cas register number is 5380-42-7. It also can be called Methyl thenoate . 2-(Methoxycarbonyl)thiophene (CAS NO.5380-42-7) is not compatible with strong oxidizing agents. And its hazardous decomposition products are carbon monoxide, oxides of sulfur, carbon dioxide. While, its hazardous polymerization has not been reported. |
| Flash Point: | 74.9°C |
| Safety Data | |
 |
|
