| Identification | |
| Name: | Benzo[b]thiophene-3-carboxaldehyde |
| Synonyms: | 1-Benzothiophene-3-carboxaldehyde;3-Benzothiophenecarboxaldehyde;3-Formylbenzo[b]thiophene;3-Thianaphthenecarboxaldehyde;Benzo[b]thiophene-3-aldehyde;Thianaphtene-3-carboxaldehyde; |
| CAS: | 5381-20-4 |
| Molecular Formula: | C9H6OS |
| Molecular Weight: | 162.21 |
| InChI: | InChI=1/C9H6OS/c10-5-7-6-11-9-4-2-1-3-8(7)9/h1-6H |
| Molecular Structure: | ![(C9H6OS) 1-Benzothiophene-3-carboxaldehyde;3-Benzothiophenecarboxaldehyde;3-Formylbenzo[b]thiophene;3-Thianap...](https://img.guidechem.com/casimg/5381-20-4.gif) |
| Properties | |
| Flash Point: | 137.2ºC |
| Density: | 1.3 g/cm3 |
| Refractive index: | 1.719 |
| Appearance: | yellow to brown crystalline powder |
| Specification: |
1-Benzothiophene-3-carbaldehyde (CAS NO.5381-20-4), its Synonyms are Thianaphthene-3-carboxaldehyde ; 1-Benzothiophene-3-carboxaldehyde ; Benzo[B]Thiophene-3-Carboxalde . It is yellow to brown crystalline powder. |
| Flash Point: | 137.2ºC |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
