| Identification | |
| Name: | 4-Chloro-2,6-dinitroaniline |
| Synonyms: | 2,6-Dinitro-4-chloroaniline;4-Chloro-2,6-dinitroaniline;AI3-62729;Aniline, 4-chloro-2,6-dinitro-;Benzenamine, 4-chloro-2,6-dinitro-;HSDB 6082;NSC 8730;Aniline, 2,6-dinitro-4-chloro-;Aniline, 4-chloro-2,6-dinitro- (8CI) |
| CAS: | 5388-62-5 |
| EINECS: | 226-381-5 |
| Molecular Formula: | C6H4ClN3O4 |
| Molecular Weight: | 217.5667 |
| InChI: | InChI=1/C6H4ClN3O4/c7-3-1-4(9(11)12)6(8)5(2-3)10(13)14/h1-2H,8H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 171.5°C |
| Boiling Point: | 359.9°C at 760 mmHg |
| Density: | 1.708g/cm3 |
| Refractive index: | 1.686 |
| Solubility: | Very soluble in ether, ethanol, acetic acid Soluble in alcohol, benzene, ether; slightly soluble in water and strong acids In water, 791 mg/L at 25 deg C (est) |
| Specification: |
4-Chloro-2,6-dinitroaniline , its CAS NO. is 5388-62-5, the synonyms are 2,6-Dinitro-4-chloroaniline ; AI3-62729 ; Aniline, 4-chloro-2,6-dinitro- ; Benzenamine, 4-chloro-2,6-dinitro- ; EINECS 226-381-5 ; HSDB 6082 ; NSC 8730 . |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 171.5°C |
| Color: | Yellow needles from water |
| Safety Data | |
 |
|
