| Identification | |
| Name: | Thioperoxydicarbonicdiamide ([(H2N)C(S)]2S2), dimethyldiphenyl- |
| Synonyms: | Dimethyldiphenylthiuramdisulfide;Vulkacit I; |
| CAS: | 53880-86-7 |
| EINECS: | 258-835-3 |
| Molecular Formula: | C16H16N2S4 |
| Molecular Weight: | 364.57 |
| InChI: | InChI=1/C16H16N2S4/c1-11-3-7-13(8-4-11)17-15(19)21-22-16(20)18-14-9-5-12(2)6-10-14/h3-10H,1-2H3,(H,17,19)(H,18,20) |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 180 oC (Min.) |
| Density: | 1.403 g/cm3 |
| Refractive index: | 1.789 |
| Appearance: | Ginger particles/ Whitish Grey to Yellow Powder |
| Specification: |
The Dimethyldiphenylthiuram disulfide, with CAS registry number 53880-86-7, has the systematic name of 1-methyl-4-[({[(4-methylphenyl)carbamothioyl]disulfanyl}carbonothioyl)amino]benzene. And its IUPAC name is (4-methylphenyl)carbamothioylsulfanyl N-(4-methylphenyl)carbamodithioate. What's more, its EINECS is 258-835-3. Physical properties of Dimethyldiphenylthiuram disulfide: (1)ACD/LogP: 6.40; (2)# of Rule of 5 Violations: 1; (3)ACD/LogD (pH 5.5): 6.4; (4)ACD/LogD (pH 7.4): 6.4; (5)ACD/BCF (pH 5.5): 43202.04; (6)ACD/BCF (pH 7.4): 42726.45; (7)ACD/KOC (pH 5.5): 72386.77; (8)ACD/KOC (pH 7.4): 71589.9; (9)#H bond acceptors: 2; (10)#H bond donors: 2; (11)#Freely Rotating Bonds: 5; (12)Polar Surface Area: 121.26 Å2; (13)Index of Refraction: 1.789; (14)Molar Refractivity: 109.89 cm3; (15)Molar Volume: 259.7 cm3; (16)Polarizability: 43.56×10-24cm3; (17)Surface Tension: 77.2 dyne/cm; (18)Enthalpy of Vaporization: 76.74 kJ/mol; (19)Vapour Pressure: 4.28E-10 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
